C20H18N4O4S — CID 86299074
18,21-dioxa-3-thia-7,15,23,27-tetrazatetracyclo[20.3.1.12,5.08,13]heptacosa-1(26),2(27),4,8,10,12,22,24-octaene-6,14-dione (PubChem CID 86299074) has the molecular formula C20H18N4O4S and a molecular weight of 410.46 g/mol. Its IUPAC name is 18,21-dioxa-3-thia-7,15,23,27-tetrazatetracyclo[20.3.1.12,5.08,13]heptacosa-1(26),2(27),4,8,10,12,22,24-octaene-6,14-dione.
| Compound Name | 18,21-dioxa-3-thia-7,15,23,27-tetrazatetracyclo[20.3.1.12,5.08,13]heptacosa-1(26),2(27),4,8,10,12,22,24-octaene-6,14-dione |
|---|---|
| PubChem CID | 86299074 |
| Molecular Formula | C20H18N4O4S |
| Molecular Weight | 410.46 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | 18,21-dioxa-3-thia-7,15,23,27-tetrazatetracyclo[20.3.1.12,5.08,13]heptacosa-1(26),2(27),4,8,10,12,22,24-octaene-6,14-dione |
| SMILES | O=C1Nc2ccccc2C(=O)NCCOCCOc2cc(ccn2)-c2nc1cs2 |
| InChI | InChI=1S/C20H18N4O4S/c25-18-14-3-1-2-4-15(14)23-19(26)16-12-29-20(24-16)13-5-6-21-17(11-13)28-10-9-27-8-7-22-18/h1-6,11-12H,7-10H2,(H,22,25)(H,23,26) |
| InChIKey | LNLNYBMQNZJKTJ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.46 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |