C25H26N4O3 — CID 86299119
1-[7-(3,5-dimethyl-1,2-oxazol-4-yl)-11-phenyl-9-oxa-1,3-diazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-2-yl]piperidin-4-ol (PubChem CID 86299119) has the molecular formula C25H26N4O3 and a molecular weight of 430.51 g/mol. Its IUPAC name is 1-[7-(3,5-dimethyl-1,2-oxazol-4-yl)-11-phenyl-9-oxa-1,3-diazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-2-yl]piperidin-4-ol.
| Compound Name | 1-[7-(3,5-dimethyl-1,2-oxazol-4-yl)-11-phenyl-9-oxa-1,3-diazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-2-yl]piperidin-4-ol |
|---|---|
| PubChem CID | 86299119 |
| Molecular Formula | C25H26N4O3 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | 1-[7-(3,5-dimethyl-1,2-oxazol-4-yl)-11-phenyl-9-oxa-1,3-diazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-2-yl]piperidin-4-ol |
| SMILES | Cc1noc(C)c1-c1ccc2nc(N3CCC(O)CC3)n3c2c1OCC3c1ccccc1 |
| InChI | InChI=1S/C25H26N4O3/c1-15-22(16(2)32-27-15)19-8-9-20-23-24(19)31-14-21(17-6-4-3-5-7-17)29(23)25(26-20)28-12-10-18(30)11-13-28/h3-9,18,21,30H,10-14H2,1-2H3 |
| InChIKey | PXEINIZFFWQLMR-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 76.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |