C19H17N5O4S — CID 86299137
18,21-dioxa-3-thia-7,12,15,23,27-pentazatetracyclo[20.3.1.12,5.08,13]heptacosa-1(26),2(27),4,8(13),9,11,22,24-octaene-6,14-dione (PubChem CID 86299137) has the molecular formula C19H17N5O4S and a molecular weight of 411.44 g/mol. Its IUPAC name is 18,21-dioxa-3-thia-7,12,15,23,27-pentazatetracyclo[20.3.1.12,5.08,13]heptacosa-1(26),2(27),4,8(13),9,11,22,24-octaene-6,14-dione.
| Compound Name | 18,21-dioxa-3-thia-7,12,15,23,27-pentazatetracyclo[20.3.1.12,5.08,13]heptacosa-1(26),2(27),4,8(13),9,11,22,24-octaene-6,14-dione |
|---|---|
| PubChem CID | 86299137 |
| Molecular Formula | C19H17N5O4S |
| Molecular Weight | 411.44 g/mol |
| Exact Mass | 411.10 |
| IUPAC Name | 18,21-dioxa-3-thia-7,12,15,23,27-pentazatetracyclo[20.3.1.12,5.08,13]heptacosa-1(26),2(27),4,8(13),9,11,22,24-octaene-6,14-dione |
| SMILES | O=C1Nc2cccnc2C(=O)NCCOCCOc2cc(ccn2)-c2nc1cs2 |
| InChI | InChI=1S/C19H17N5O4S/c25-17-14-11-29-19(24-14)12-3-5-20-15(10-12)28-9-8-27-7-6-22-18(26)16-13(23-17)2-1-4-21-16/h1-5,10-11H,6-9H2,(H,22,26)(H,23,25) |
| InChIKey | GDLVSVMIXOQHCE-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 115.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.44 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |