C22H25N7O3S — CID 86299141
10-(oxan-4-yl)-3-thia-7,10,11,14,19,21,25-heptazatetracyclo[18.3.1.12,5.08,12]pentacosa-1(24),2(25),4,8,11,20,22-heptaene-6,13-dione (PubChem CID 86299141) has the molecular formula C22H25N7O3S and a molecular weight of 467.56 g/mol. Its IUPAC name is 10-(oxan-4-yl)-3-thia-7,10,11,14,19,21,25-heptazatetracyclo[18.3.1.12,5.08,12]pentacosa-1(24),2(25),4,8,11,20,22-heptaene-6,13-dione.
| Compound Name | 10-(oxan-4-yl)-3-thia-7,10,11,14,19,21,25-heptazatetracyclo[18.3.1.12,5.08,12]pentacosa-1(24),2(25),4,8,11,20,22-heptaene-6,13-dione |
|---|---|
| PubChem CID | 86299141 |
| Molecular Formula | C22H25N7O3S |
| Molecular Weight | 467.56 g/mol |
| Exact Mass | 467.17 |
| IUPAC Name | 10-(oxan-4-yl)-3-thia-7,10,11,14,19,21,25-heptazatetracyclo[18.3.1.12,5.08,12]pentacosa-1(24),2(25),4,8,11,20,22-heptaene-6,13-dione |
| SMILES | O=C1Nc2cn(C3CCOCC3)nc2C(=O)NCCCCNc2cc(ccn2)-c2nc1cs2 |
| InChI | InChI=1S/C22H25N7O3S/c30-20-17-13-33-22(27-17)14-3-8-24-18(11-14)23-6-1-2-7-25-21(31)19-16(26-20)12-29(28-19)15-4-9-32-10-5-15/h3,8,11-13,15H,1-2,4-7,9-10H2,(H,23,24)(H,25,31)(H,26,30) |
| InChIKey | AWLFKTBVVHIGNW-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 123.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.56 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |