C18H18N6O3S — CID 86299142
10-methyl-17-oxa-3-thia-7,10,11,14,21,25-hexazatetracyclo[18.3.1.12,5.08,12]pentacosa-1(24),2(25),4,8,11,20,22-heptaene-6,13-dione (PubChem CID 86299142) has the molecular formula C18H18N6O3S and a molecular weight of 398.45 g/mol. Its IUPAC name is 10-methyl-17-oxa-3-thia-7,10,11,14,21,25-hexazatetracyclo[18.3.1.12,5.08,12]pentacosa-1(24),2(25),4,8,11,20,22-heptaene-6,13-dione.
| Compound Name | 10-methyl-17-oxa-3-thia-7,10,11,14,21,25-hexazatetracyclo[18.3.1.12,5.08,12]pentacosa-1(24),2(25),4,8,11,20,22-heptaene-6,13-dione |
|---|---|
| PubChem CID | 86299142 |
| Molecular Formula | C18H18N6O3S |
| Molecular Weight | 398.45 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | 10-methyl-17-oxa-3-thia-7,10,11,14,21,25-hexazatetracyclo[18.3.1.12,5.08,12]pentacosa-1(24),2(25),4,8,11,20,22-heptaene-6,13-dione |
| SMILES | Cn1cc2c(n1)C(=O)NCCOCCc1cc(ccn1)-c1nc(cs1)C(=O)N2 |
| InChI | InChI=1S/C18H18N6O3S/c1-24-9-13-15(23-24)17(26)20-5-7-27-6-3-12-8-11(2-4-19-12)18-22-14(10-28-18)16(25)21-13/h2,4,8-10H,3,5-7H2,1H3,(H,20,26)(H,21,25) |
| InChIKey | TZBYQGXEUNGBLZ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 111.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.45 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |