C21H20N4O3 — CID 86299177
7-(3,5-dimethyl-1,2-oxazol-4-yl)-3-methoxy-11-pyridin-2-yl-1,3-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7-trien-2-one (PubChem CID 86299177) has the molecular formula C21H20N4O3 and a molecular weight of 376.42 g/mol. Its IUPAC name is 7-(3,5-dimethyl-1,2-oxazol-4-yl)-3-methoxy-11-pyridin-2-yl-1,3-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7-trien-2-one.
| Compound Name | 7-(3,5-dimethyl-1,2-oxazol-4-yl)-3-methoxy-11-pyridin-2-yl-1,3-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7-trien-2-one |
|---|---|
| PubChem CID | 86299177 |
| Molecular Formula | C21H20N4O3 |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | 7-(3,5-dimethyl-1,2-oxazol-4-yl)-3-methoxy-11-pyridin-2-yl-1,3-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7-trien-2-one |
| SMILES | COn1c(=O)n2c3c(c(-c4c(C)noc4C)ccc31)CCC2c1ccccn1 |
| InChI | InChI=1S/C21H20N4O3/c1-12-19(13(2)28-23-12)14-7-10-18-20-15(14)8-9-17(16-6-4-5-11-22-16)24(20)21(26)25(18)27-3/h4-7,10-11,17H,8-9H2,1-3H3 |
| InChIKey | HGWSQOYAERODMJ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 75.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |