C20H22N4O2S — CID 86299284
14-oxa-3-thia-7,22,23,26-tetrazatetracyclo[20.2.1.12,5.08,13]hexacosa-1(25),2(26),4,8,10,12,23-heptaen-6-one (PubChem CID 86299284) has the molecular formula C20H22N4O2S and a molecular weight of 382.49 g/mol. Its IUPAC name is 14-oxa-3-thia-7,22,23,26-tetrazatetracyclo[20.2.1.12,5.08,13]hexacosa-1(25),2(26),4,8,10,12,23-heptaen-6-one.
| Compound Name | 14-oxa-3-thia-7,22,23,26-tetrazatetracyclo[20.2.1.12,5.08,13]hexacosa-1(25),2(26),4,8,10,12,23-heptaen-6-one |
|---|---|
| PubChem CID | 86299284 |
| Molecular Formula | C20H22N4O2S |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | 14-oxa-3-thia-7,22,23,26-tetrazatetracyclo[20.2.1.12,5.08,13]hexacosa-1(25),2(26),4,8,10,12,23-heptaen-6-one |
| SMILES | O=C1Nc2ccccc2OCCCCCCCn2cc(cn2)-c2nc1cs2 |
| InChI | InChI=1S/C20H22N4O2S/c25-19-17-14-27-20(23-17)15-12-21-24(13-15)10-6-2-1-3-7-11-26-18-9-5-4-8-16(18)22-19/h4-5,8-9,12-14H,1-3,6-7,10-11H2,(H,22,25) |
| InChIKey | WAJICUXTGZWFLS-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |