C17H16F3N7O2 — CID 86299349
5-amino-N-[4-(2,2,2-trifluoroethoxy)-3-pyridinyl]-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1,3,5,8-tetraene-4-carboxamide (PubChem CID 86299349) has the molecular formula C17H16F3N7O2 and a molecular weight of 407.36 g/mol. Its IUPAC name is 5-amino-N-[4-(2,2,2-trifluoroethoxy)-3-pyridinyl]-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1,3,5,8-tetraene-4-carboxamide.
| Compound Name | 5-amino-N-[4-(2,2,2-trifluoroethoxy)-3-pyridinyl]-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1,3,5,8-tetraene-4-carboxamide |
|---|---|
| PubChem CID | 86299349 |
| Molecular Formula | C17H16F3N7O2 |
| Molecular Weight | 407.36 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | 5-amino-N-[4-(2,2,2-trifluoroethoxy)-3-pyridinyl]-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1,3,5,8-tetraene-4-carboxamide |
| SMILES | Nc1nn2cc3c(nc2c1C(=O)Nc1cnccc1OCC(F)(F)F)CCNC3 |
| InChI | InChI=1S/C17H16F3N7O2/c18-17(19,20)8-29-12-2-4-23-6-11(12)25-16(28)13-14(21)26-27-7-9-5-22-3-1-10(9)24-15(13)27/h2,4,6-7,22H,1,3,5,8H2,(H2,21,26)(H,25,28) |
| InChIKey | LGYUFACEKCOSMS-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 119.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.36 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |