About 6,7-dichloro-4H-thieno[3,2-c]chromene-2-carboxylic acid
6,7-dichloro-4H-thieno[3,2-c]chromene-2-carboxylic acid (PubChem CID 86299361) has the molecular formula C12H6Cl2O3S
and a molecular weight of 301.15 g/mol. Its IUPAC name is 6,7-dichloro-4H-thieno[3,2-c]chromene-2-carboxylic acid.
Molecular Properties
| Compound Name | 6,7-dichloro-4H-thieno[3,2-c]chromene-2-carboxylic acid |
| PubChem CID | 86299361 |
| Molecular Formula | C12H6Cl2O3S |
| Molecular Weight | 301.15 g/mol |
| Exact Mass | 299.94 |
| IUPAC Name | 6,7-dichloro-4H-thieno[3,2-c]chromene-2-carboxylic acid |
| SMILES | O=C(O)c1cc2c(s1)-c1ccc(Cl)c(Cl)c1OC2 |
| InChI | InChI=1S/C12H6Cl2O3S/c13-7-2-1-6-10(9(7)14)17-4-5-3-8(12(15)16)18-11(5)6/h1-3H,4H2,(H,15,16) |
| InChIKey | LIBRZGKAMVTQDT-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.15 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6,7-dichloro-4H-thieno[3,2-c]chromene-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dichloro-4H-thieno[3,2-c]chromene-2-carboxylic acid?
The IUPAC name of 6,7-dichloro-4H-thieno[3,2-c]chromene-2-carboxylic acid (CID 86299361) is 6,7-dichloro-4H-thieno[3,2-c]chromene-2-carboxylic acid.
What is the SMILES notation for 6,7-dichloro-4H-thieno[3,2-c]chromene-2-carboxylic acid?
The canonical SMILES for 6,7-dichloro-4H-thieno[3,2-c]chromene-2-carboxylic acid is O=C(O)c1cc2c(s1)-c1ccc(Cl)c(Cl)c1OC2.
What is the InChIKey of 6,7-dichloro-4H-thieno[3,2-c]chromene-2-carboxylic acid?
The InChIKey is LIBRZGKAMVTQDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H6Cl2O3S/c13-7-2-1-6-10(9(7)14)17-4-5-3-8(12(15)16)18-11(5)6/h1-3H,4H2,(H,15,16).
What are the key properties of 6,7-dichloro-4H-thieno[3,2-c]chromene-2-carboxylic acid?
6,7-dichloro-4H-thieno[3,2-c]chromene-2-carboxylic acid has a molecular weight of 301.15 g/mol, XLogP of 4.31, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dichloro-4H-thieno[3,2-c]chromene-2-carboxylic acid is sourced from PubChem (CID 86299361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).