C27H33N7O5 — CID 86299420
tert-butyl (18E)-10-methyl-6,13-dioxo-3-oxa-7,10,11,14,23,25,29-heptazatetracyclo[22.3.1.12,5.08,12]nonacosa-1(28),2(29),4,8,11,18,24,26-octaene-23-carboxylate (PubChem CID 86299420) has the molecular formula C27H33N7O5 and a molecular weight of 535.61 g/mol. Its IUPAC name is tert-butyl (18E)-10-methyl-6,13-dioxo-3-oxa-7,10,11,14,23,25,29-heptazatetracyclo[22.3.1.12,5.08,12]nonacosa-1(28),2(29),4,8,11,18,24,26-octaene-23-carboxylate.
| Compound Name | tert-butyl (18E)-10-methyl-6,13-dioxo-3-oxa-7,10,11,14,23,25,29-heptazatetracyclo[22.3.1.12,5.08,12]nonacosa-1(28),2(29),4,8,11,18,24,26-octaene-23-carboxylate |
|---|---|
| PubChem CID | 86299420 |
| Molecular Formula | C27H33N7O5 |
| Molecular Weight | 535.61 g/mol |
| Exact Mass | 535.25 |
| IUPAC Name | tert-butyl (18E)-10-methyl-6,13-dioxo-3-oxa-7,10,11,14,23,25,29-heptazatetracyclo[22.3.1.12,5.08,12]nonacosa-1(28),2(29),4,8,11,18,24,26-octaene-23-carboxylate |
| SMILES | Cn1cc2c(n1)C(=O)NCCC/C=C/CCCN(C(=O)OC(C)(C)C)c1cc(ccn1)-c1nc(co1)C(=O)N2 |
| InChI | InChI=1S/C27H33N7O5/c1-27(2,3)39-26(37)34-14-10-8-6-5-7-9-12-29-24(36)22-19(16-33(4)32-22)30-23(35)20-17-38-25(31-20)18-11-13-28-21(34)15-18/h5-6,11,13,15-17H,7-10,12,14H2,1-4H3,(H,29,36)(H,30,35)/b6-5+ |
| InChIKey | BBOIQBUIQKUHDC-AATRIKPKSA-N |
| XLogP | 4.32 |
| TPSA | 144.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.61 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|