C18H19N7O3 — CID 86299493
10-methyl-3-oxa-7,10,11,14,19,21,25-heptazatetracyclo[18.3.1.12,5.08,12]pentacosa-1(24),2(25),4,8,11,20,22-heptaene-6,13-dione (PubChem CID 86299493) has the molecular formula C18H19N7O3 and a molecular weight of 381.40 g/mol. Its IUPAC name is 10-methyl-3-oxa-7,10,11,14,19,21,25-heptazatetracyclo[18.3.1.12,5.08,12]pentacosa-1(24),2(25),4,8,11,20,22-heptaene-6,13-dione.
| Compound Name | 10-methyl-3-oxa-7,10,11,14,19,21,25-heptazatetracyclo[18.3.1.12,5.08,12]pentacosa-1(24),2(25),4,8,11,20,22-heptaene-6,13-dione |
|---|---|
| PubChem CID | 86299493 |
| Molecular Formula | C18H19N7O3 |
| Molecular Weight | 381.40 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | 10-methyl-3-oxa-7,10,11,14,19,21,25-heptazatetracyclo[18.3.1.12,5.08,12]pentacosa-1(24),2(25),4,8,11,20,22-heptaene-6,13-dione |
| SMILES | Cn1cc2c(n1)C(=O)NCCCCNc1cc(ccn1)-c1nc(co1)C(=O)N2 |
| InChI | InChI=1S/C18H19N7O3/c1-25-9-12-15(24-25)17(27)21-6-3-2-5-19-14-8-11(4-7-20-14)18-23-13(10-28-18)16(26)22-12/h4,7-10H,2-3,5-6H2,1H3,(H,19,20)(H,21,27)(H,22,26) |
| InChIKey | NSYGQXGJPYUIBP-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 126.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.40 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |