C20H23N7O3 — CID 86299494
10-methyl-3-oxa-7,10,11,14,21,23,27-heptazatetracyclo[20.3.1.12,5.08,12]heptacosa-1(26),2(27),4,8,11,22,24-heptaene-6,13-dione (PubChem CID 86299494) has the molecular formula C20H23N7O3 and a molecular weight of 409.45 g/mol. Its IUPAC name is 10-methyl-3-oxa-7,10,11,14,21,23,27-heptazatetracyclo[20.3.1.12,5.08,12]heptacosa-1(26),2(27),4,8,11,22,24-heptaene-6,13-dione.
| Compound Name | 10-methyl-3-oxa-7,10,11,14,21,23,27-heptazatetracyclo[20.3.1.12,5.08,12]heptacosa-1(26),2(27),4,8,11,22,24-heptaene-6,13-dione |
|---|---|
| PubChem CID | 86299494 |
| Molecular Formula | C20H23N7O3 |
| Molecular Weight | 409.45 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | 10-methyl-3-oxa-7,10,11,14,21,23,27-heptazatetracyclo[20.3.1.12,5.08,12]heptacosa-1(26),2(27),4,8,11,22,24-heptaene-6,13-dione |
| SMILES | Cn1cc2c(n1)C(=O)NCCCCCCNc1cc(ccn1)-c1nc(co1)C(=O)N2 |
| InChI | InChI=1S/C20H23N7O3/c1-27-11-14-17(26-27)19(29)23-8-5-3-2-4-7-21-16-10-13(6-9-22-16)20-25-15(12-30-20)18(28)24-14/h6,9-12H,2-5,7-8H2,1H3,(H,21,22)(H,23,29)(H,24,28) |
| InChIKey | HWFAZKBSMJZQKW-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 126.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.45 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |