C19H21N7O3 — CID 86299495
10-methyl-3-oxa-7,10,11,14,20,22,26-heptazatetracyclo[19.3.1.12,5.08,12]hexacosa-1(25),2(26),4,8,11,21,23-heptaene-6,13-dione (PubChem CID 86299495) has the molecular formula C19H21N7O3 and a molecular weight of 395.42 g/mol. Its IUPAC name is 10-methyl-3-oxa-7,10,11,14,20,22,26-heptazatetracyclo[19.3.1.12,5.08,12]hexacosa-1(25),2(26),4,8,11,21,23-heptaene-6,13-dione.
| Compound Name | 10-methyl-3-oxa-7,10,11,14,20,22,26-heptazatetracyclo[19.3.1.12,5.08,12]hexacosa-1(25),2(26),4,8,11,21,23-heptaene-6,13-dione |
|---|---|
| PubChem CID | 86299495 |
| Molecular Formula | C19H21N7O3 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | 10-methyl-3-oxa-7,10,11,14,20,22,26-heptazatetracyclo[19.3.1.12,5.08,12]hexacosa-1(25),2(26),4,8,11,21,23-heptaene-6,13-dione |
| SMILES | Cn1cc2c(n1)C(=O)NCCCCCNc1cc(ccn1)-c1nc(co1)C(=O)N2 |
| InChI | InChI=1S/C19H21N7O3/c1-26-10-13-16(25-26)18(28)22-7-4-2-3-6-20-15-9-12(5-8-21-15)19-24-14(11-29-19)17(27)23-13/h5,8-11H,2-4,6-7H2,1H3,(H,20,21)(H,22,28)(H,23,27) |
| InChIKey | IULBTOOKCQDVPC-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 126.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |