C19H20N6O3 — CID 86299572
10-methyl-3-oxa-7,10,11,14,21,25-hexazatetracyclo[18.3.1.12,5.08,12]pentacosa-1(24),2(25),4,8,11,20,22-heptaene-6,13-dione (PubChem CID 86299572) has the molecular formula C19H20N6O3 and a molecular weight of 380.41 g/mol. Its IUPAC name is 10-methyl-3-oxa-7,10,11,14,21,25-hexazatetracyclo[18.3.1.12,5.08,12]pentacosa-1(24),2(25),4,8,11,20,22-heptaene-6,13-dione.
| Compound Name | 10-methyl-3-oxa-7,10,11,14,21,25-hexazatetracyclo[18.3.1.12,5.08,12]pentacosa-1(24),2(25),4,8,11,20,22-heptaene-6,13-dione |
|---|---|
| PubChem CID | 86299572 |
| Molecular Formula | C19H20N6O3 |
| Molecular Weight | 380.41 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | 10-methyl-3-oxa-7,10,11,14,21,25-hexazatetracyclo[18.3.1.12,5.08,12]pentacosa-1(24),2(25),4,8,11,20,22-heptaene-6,13-dione |
| SMILES | Cn1cc2c(n1)C(=O)NCCCCCc1cc(ccn1)-c1nc(co1)C(=O)N2 |
| InChI | InChI=1S/C19H20N6O3/c1-25-10-14-16(24-25)18(27)21-7-4-2-3-5-13-9-12(6-8-20-13)19-23-15(11-28-19)17(26)22-14/h6,8-11H,2-5,7H2,1H3,(H,21,27)(H,22,26) |
| InChIKey | MCYJFKFKZWEJIM-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 114.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.41 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |