About [(1R)-1-(2,6-difluorophenoxy)carbonyloxyethyl] 2-methylpropanoate
[(1R)-1-(2,6-difluorophenoxy)carbonyloxyethyl] 2-methylpropanoate (PubChem CID 86299635) has the molecular formula C13H14F2O5
and a molecular weight of 288.25 g/mol. Its IUPAC name is [(1R)-1-(2,6-difluorophenoxy)carbonyloxyethyl] 2-methylpropanoate.
Molecular Properties
| Compound Name | [(1R)-1-(2,6-difluorophenoxy)carbonyloxyethyl] 2-methylpropanoate |
| PubChem CID | 86299635 |
| Molecular Formula | C13H14F2O5 |
| Molecular Weight | 288.25 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | [(1R)-1-(2,6-difluorophenoxy)carbonyloxyethyl] 2-methylpropanoate |
| SMILES | CC(C)C(=O)O[C@@H](C)OC(=O)Oc1c(F)cccc1F |
| InChI | InChI=1S/C13H14F2O5/c1-7(2)12(16)18-8(3)19-13(17)20-11-9(14)5-4-6-10(11)15/h4-8H,1-3H3/t8-/m1/s1 |
| InChIKey | HOHYPINFSWJKBB-MRVPVSSYSA-N |
| XLogP | 3.03 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.25 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze [(1R)-1-(2,6-difluorophenoxy)carbonyloxyethyl] 2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R)-1-(2,6-difluorophenoxy)carbonyloxyethyl] 2-methylpropanoate?
The IUPAC name of [(1R)-1-(2,6-difluorophenoxy)carbonyloxyethyl] 2-methylpropanoate (CID 86299635) is [(1R)-1-(2,6-difluorophenoxy)carbonyloxyethyl] 2-methylpropanoate.
What is the SMILES notation for [(1R)-1-(2,6-difluorophenoxy)carbonyloxyethyl] 2-methylpropanoate?
The canonical SMILES for [(1R)-1-(2,6-difluorophenoxy)carbonyloxyethyl] 2-methylpropanoate is CC(C)C(=O)O[C@@H](C)OC(=O)Oc1c(F)cccc1F.
What is the InChIKey of [(1R)-1-(2,6-difluorophenoxy)carbonyloxyethyl] 2-methylpropanoate?
The InChIKey is HOHYPINFSWJKBB-MRVPVSSYSA-N. The full InChI is InChI=1S/C13H14F2O5/c1-7(2)12(16)18-8(3)19-13(17)20-11-9(14)5-4-6-10(11)15/h4-8H,1-3H3/t8-/m1/s1.
What are the key properties of [(1R)-1-(2,6-difluorophenoxy)carbonyloxyethyl] 2-methylpropanoate?
[(1R)-1-(2,6-difluorophenoxy)carbonyloxyethyl] 2-methylpropanoate has a molecular weight of 288.25 g/mol, XLogP of 3.03, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R)-1-(2,6-difluorophenoxy)carbonyloxyethyl] 2-methylpropanoate is sourced from PubChem (CID 86299635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).