C22H24N6O6 — CID 86299640
10-(oxan-4-yl)-3,17,20-trioxa-7,10,11,14,22,26-hexazatetracyclo[19.3.1.12,5.08,12]hexacosa-1(25),2(26),4,8,11,21,23-heptaene-6,13-dione (PubChem CID 86299640) has the molecular formula C22H24N6O6 and a molecular weight of 468.47 g/mol. Its IUPAC name is 10-(oxan-4-yl)-3,17,20-trioxa-7,10,11,14,22,26-hexazatetracyclo[19.3.1.12,5.08,12]hexacosa-1(25),2(26),4,8,11,21,23-heptaene-6,13-dione.
| Compound Name | 10-(oxan-4-yl)-3,17,20-trioxa-7,10,11,14,22,26-hexazatetracyclo[19.3.1.12,5.08,12]hexacosa-1(25),2(26),4,8,11,21,23-heptaene-6,13-dione |
|---|---|
| PubChem CID | 86299640 |
| Molecular Formula | C22H24N6O6 |
| Molecular Weight | 468.47 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | 10-(oxan-4-yl)-3,17,20-trioxa-7,10,11,14,22,26-hexazatetracyclo[19.3.1.12,5.08,12]hexacosa-1(25),2(26),4,8,11,21,23-heptaene-6,13-dione |
| SMILES | O=C1Nc2cn(C3CCOCC3)nc2C(=O)NCCOCCOc2cc(ccn2)-c2nc1co2 |
| InChI | InChI=1S/C22H24N6O6/c29-20-17-13-34-22(26-17)14-1-4-23-18(11-14)33-10-9-32-8-5-24-21(30)19-16(25-20)12-28(27-19)15-2-6-31-7-3-15/h1,4,11-13,15H,2-3,5-10H2,(H,24,30)(H,25,29) |
| InChIKey | QBRZHUUGEXCWBE-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 142.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.47 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |