C17H21N3O3 — CID 86299716
7-ethyl-3,14-dioxa-7,16,20-triazatricyclo[13.3.1.12,5]icosa-1(19),2(20),4,15,17-pentaen-6-one (PubChem CID 86299716) has the molecular formula C17H21N3O3 and a molecular weight of 315.37 g/mol. Its IUPAC name is 7-ethyl-3,14-dioxa-7,16,20-triazatricyclo[13.3.1.12,5]icosa-1(19),2(20),4,15,17-pentaen-6-one.
| Compound Name | 7-ethyl-3,14-dioxa-7,16,20-triazatricyclo[13.3.1.12,5]icosa-1(19),2(20),4,15,17-pentaen-6-one |
|---|---|
| PubChem CID | 86299716 |
| Molecular Formula | C17H21N3O3 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | 7-ethyl-3,14-dioxa-7,16,20-triazatricyclo[13.3.1.12,5]icosa-1(19),2(20),4,15,17-pentaen-6-one |
| SMILES | CCN1CCCCCCOc2cc(ccn2)-c2nc(co2)C1=O |
| InChI | InChI=1S/C17H21N3O3/c1-2-20-9-5-3-4-6-10-22-15-11-13(7-8-18-15)16-19-14(12-23-16)17(20)21/h7-8,11-12H,2-6,9-10H2,1H3 |
| InChIKey | QMYFRHMDTANEME-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 68.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |