C15H17N3O3 — CID 86299790
3,14-dioxa-7,16,20-triazatricyclo[13.3.1.12,5]icosa-1(19),2(20),4,15,17-pentaen-6-one (PubChem CID 86299790) has the molecular formula C15H17N3O3 and a molecular weight of 287.32 g/mol. Its IUPAC name is 3,14-dioxa-7,16,20-triazatricyclo[13.3.1.12,5]icosa-1(19),2(20),4,15,17-pentaen-6-one.
| Compound Name | 3,14-dioxa-7,16,20-triazatricyclo[13.3.1.12,5]icosa-1(19),2(20),4,15,17-pentaen-6-one |
|---|---|
| PubChem CID | 86299790 |
| Molecular Formula | C15H17N3O3 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | 3,14-dioxa-7,16,20-triazatricyclo[13.3.1.12,5]icosa-1(19),2(20),4,15,17-pentaen-6-one |
| SMILES | O=C1NCCCCCCOc2cc(ccn2)-c2nc1co2 |
| InChI | InChI=1S/C15H17N3O3/c19-14-12-10-21-15(18-12)11-5-7-16-13(9-11)20-8-4-2-1-3-6-17-14/h5,7,9-10H,1-4,6,8H2,(H,17,19) |
| InChIKey | ZONVDSQEECDNDU-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |