C17H22N4O2 — CID 86299794
3-oxa-7,16,18,22-tetrazatricyclo[15.3.1.12,5]docosa-1(21),2(22),4,17,19-pentaen-6-one (PubChem CID 86299794) has the molecular formula C17H22N4O2 and a molecular weight of 314.39 g/mol. Its IUPAC name is 3-oxa-7,16,18,22-tetrazatricyclo[15.3.1.12,5]docosa-1(21),2(22),4,17,19-pentaen-6-one.
| Compound Name | 3-oxa-7,16,18,22-tetrazatricyclo[15.3.1.12,5]docosa-1(21),2(22),4,17,19-pentaen-6-one |
|---|---|
| PubChem CID | 86299794 |
| Molecular Formula | C17H22N4O2 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | 3-oxa-7,16,18,22-tetrazatricyclo[15.3.1.12,5]docosa-1(21),2(22),4,17,19-pentaen-6-one |
| SMILES | O=C1NCCCCCCCCNc2cc(ccn2)-c2nc1co2 |
| InChI | InChI=1S/C17H22N4O2/c22-16-14-12-23-17(21-14)13-7-10-19-15(11-13)18-8-5-3-1-2-4-6-9-20-16/h7,10-12H,1-6,8-9H2,(H,18,19)(H,20,22) |
| InChIKey | VJIHOCSQPZTLPT-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |