C23H16ClF2N3O2 — CID 86300269
N-[2-chloro-5-[3-(3,5-difluoro-2-methoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]phenyl]prop-2-enamide (PubChem CID 86300269) has the molecular formula C23H16ClF2N3O2 and a molecular weight of 439.85 g/mol. Its IUPAC name is N-[2-chloro-5-[3-(3,5-difluoro-2-methoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]phenyl]prop-2-enamide.
| Compound Name | N-[2-chloro-5-[3-(3,5-difluoro-2-methoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 86300269 |
| Molecular Formula | C23H16ClF2N3O2 |
| Molecular Weight | 439.85 g/mol |
| Exact Mass | 439.09 |
| IUPAC Name | N-[2-chloro-5-[3-(3,5-difluoro-2-methoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(-c2cnc3[nH]cc(-c4cc(F)cc(F)c4OC)c3c2)ccc1Cl |
| InChI | InChI=1S/C23H16ClF2N3O2/c1-3-21(30)29-20-7-12(4-5-18(20)24)13-6-16-17(11-28-23(16)27-10-13)15-8-14(25)9-19(26)22(15)31-2/h3-11H,1H2,2H3,(H,27,28)(H,29,30) |
| InChIKey | NKUPOMQOUHJVKE-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.85 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|