C16H13N3O2 — CID 86300420
N-[3-(2-oxo-1,3-dihydropyrrolo[2,3-b]pyridin-5-yl)phenyl]prop-2-enamide (PubChem CID 86300420) has the molecular formula C16H13N3O2 and a molecular weight of 279.30 g/mol. Its IUPAC name is N-[3-(2-oxo-1,3-dihydropyrrolo[2,3-b]pyridin-5-yl)phenyl]prop-2-enamide.
| Compound Name | N-[3-(2-oxo-1,3-dihydropyrrolo[2,3-b]pyridin-5-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 86300420 |
| Molecular Formula | C16H13N3O2 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | N-[3-(2-oxo-1,3-dihydropyrrolo[2,3-b]pyridin-5-yl)phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(-c2cnc3c(c2)CC(=O)N3)c1 |
| InChI | InChI=1S/C16H13N3O2/c1-2-14(20)18-13-5-3-4-10(7-13)12-6-11-8-15(21)19-16(11)17-9-12/h2-7,9H,1,8H2,(H,18,20)(H,17,19,21) |
| InChIKey | YDVJLFLSMZJGFQ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|