C20H20N4O2S — CID 86300976
14-oxa-3-thia-7,20,22,26-tetrazatetracyclo[19.3.1.12,5.08,13]hexacosa-1(25),2(26),4,8,10,12,21,23-octaen-6-one (PubChem CID 86300976) has the molecular formula C20H20N4O2S and a molecular weight of 380.47 g/mol. Its IUPAC name is 14-oxa-3-thia-7,20,22,26-tetrazatetracyclo[19.3.1.12,5.08,13]hexacosa-1(25),2(26),4,8,10,12,21,23-octaen-6-one.
| Compound Name | 14-oxa-3-thia-7,20,22,26-tetrazatetracyclo[19.3.1.12,5.08,13]hexacosa-1(25),2(26),4,8,10,12,21,23-octaen-6-one |
|---|---|
| PubChem CID | 86300976 |
| Molecular Formula | C20H20N4O2S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | 14-oxa-3-thia-7,20,22,26-tetrazatetracyclo[19.3.1.12,5.08,13]hexacosa-1(25),2(26),4,8,10,12,21,23-octaen-6-one |
| SMILES | O=C1Nc2ccccc2OCCCCCNc2cc(ccn2)-c2nc1cs2 |
| InChI | InChI=1S/C20H20N4O2S/c25-19-16-13-27-20(24-16)14-8-10-22-18(12-14)21-9-4-1-5-11-26-17-7-3-2-6-15(17)23-19/h2-3,6-8,10,12-13H,1,4-5,9,11H2,(H,21,22)(H,23,25) |
| InChIKey | IQYJLEUTKRHVLL-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |