C19H19N7O5S — CID 86300977
2-(6,13-dioxo-17,20-dioxa-3-thia-7,10,11,14,22,26-hexazatetracyclo[19.3.1.12,5.08,12]hexacosa-1(25),2(26),4,8,11,21,23-heptaen-10-yl)acetamide (PubChem CID 86300977) has the molecular formula C19H19N7O5S and a molecular weight of 457.47 g/mol. Its IUPAC name is 2-(6,13-dioxo-17,20-dioxa-3-thia-7,10,11,14,22,26-hexazatetracyclo[19.3.1.12,5.08,12]hexacosa-1(25),2(26),4,8,11,21,23-heptaen-10-yl)acetamide.
| Compound Name | 2-(6,13-dioxo-17,20-dioxa-3-thia-7,10,11,14,22,26-hexazatetracyclo[19.3.1.12,5.08,12]hexacosa-1(25),2(26),4,8,11,21,23-heptaen-10-yl)acetamide |
|---|---|
| PubChem CID | 86300977 |
| Molecular Formula | C19H19N7O5S |
| Molecular Weight | 457.47 g/mol |
| Exact Mass | 457.12 |
| IUPAC Name | 2-(6,13-dioxo-17,20-dioxa-3-thia-7,10,11,14,22,26-hexazatetracyclo[19.3.1.12,5.08,12]hexacosa-1(25),2(26),4,8,11,21,23-heptaen-10-yl)acetamide |
| SMILES | NC(=O)Cn1cc2c(n1)C(=O)NCCOCCOc1cc(ccn1)-c1nc(cs1)C(=O)N2 |
| InChI | InChI=1S/C19H19N7O5S/c20-14(27)9-26-8-12-16(25-26)18(29)22-3-4-30-5-6-31-15-7-11(1-2-21-15)19-24-13(10-32-19)17(28)23-12/h1-2,7-8,10H,3-6,9H2,(H2,20,27)(H,22,29)(H,23,28) |
| InChIKey | AFAWIWFXBHNHFV-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 163.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.47 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |