C18H18ClN5O — CID 86301138
(E)-N-[2-chloro-5-(3-methyl-2H-pyrazolo[3,4-b]pyridin-5-yl)phenyl]-3-(dimethylamino)prop-2-enamide (PubChem CID 86301138) has the molecular formula C18H18ClN5O and a molecular weight of 355.83 g/mol. Its IUPAC name is (E)-N-[2-chloro-5-(3-methyl-2H-pyrazolo[3,4-b]pyridin-5-yl)phenyl]-3-(dimethylamino)prop-2-enamide.
| Compound Name | (E)-N-[2-chloro-5-(3-methyl-2H-pyrazolo[3,4-b]pyridin-5-yl)phenyl]-3-(dimethylamino)prop-2-enamide |
|---|---|
| PubChem CID | 86301138 |
| Molecular Formula | C18H18ClN5O |
| Molecular Weight | 355.83 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | (E)-N-[2-chloro-5-(3-methyl-2H-pyrazolo[3,4-b]pyridin-5-yl)phenyl]-3-(dimethylamino)prop-2-enamide |
| SMILES | Cc1[nH]nc2ncc(-c3ccc(Cl)c(NC(=O)/C=C/N(C)C)c3)cc12 |
| InChI | InChI=1S/C18H18ClN5O/c1-11-14-8-13(10-20-18(14)23-22-11)12-4-5-15(19)16(9-12)21-17(25)6-7-24(2)3/h4-10H,1-3H3,(H,21,25)(H,20,22,23)/b7-6+ |
| InChIKey | HZXFVDJXOKIZTO-VOTSOKGWSA-N |
| XLogP | 3.60 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.83 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|