C31H24F4N6O4S — CID 86301270
N-[4-[1-(benzenesulfonyl)indol-3-yl]-5-fluoropyrimidin-2-yl]-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indol-8-amine;2,2,2-trifluoroacetic acid (PubChem CID 86301270) has the molecular formula C31H24F4N6O4S and a molecular weight of 652.63 g/mol. Its IUPAC name is N-[4-[1-(benzenesulfonyl)indol-3-yl]-5-fluoropyrimidin-2-yl]-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indol-8-amine;2,2,2-trifluoroacetic acid.
| Compound Name | N-[4-[1-(benzenesulfonyl)indol-3-yl]-5-fluoropyrimidin-2-yl]-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indol-8-amine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 86301270 |
| Molecular Formula | C31H24F4N6O4S |
| Molecular Weight | 652.63 g/mol |
| Exact Mass | 652.15 |
| IUPAC Name | N-[4-[1-(benzenesulfonyl)indol-3-yl]-5-fluoropyrimidin-2-yl]-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indol-8-amine;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=S(=O)(c1ccccc1)n1cc(-c2nc(Nc3ccc4[nH]c5c(c4c3)CNCC5)ncc2F)c2ccccc21 |
| InChI | InChI=1S/C29H23FN6O2S.C2HF3O2/c30-24-16-32-29(33-18-10-11-25-21(14-18)22-15-31-13-12-26(22)34-25)35-28(24)23-17-36(27-9-5-4-8-20(23)27)39(37,38)19-6-2-1-3-7-19;3-2(4,5)1(6)7/h1-11,14,16-17,31,34H,12-13,15H2,(H,32,33,35);(H,6,7) |
| InChIKey | NCAZOTARPKILNA-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 142.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.63 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|