C29H23FN6O2S — CID 86301271
N-[4-[1-(benzenesulfonyl)indol-3-yl]-5-fluoropyrimidin-2-yl]-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indol-8-amine (PubChem CID 86301271) has the molecular formula C29H23FN6O2S and a molecular weight of 538.61 g/mol. Its IUPAC name is N-[4-[1-(benzenesulfonyl)indol-3-yl]-5-fluoropyrimidin-2-yl]-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indol-8-amine.
| Compound Name | N-[4-[1-(benzenesulfonyl)indol-3-yl]-5-fluoropyrimidin-2-yl]-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indol-8-amine |
|---|---|
| PubChem CID | 86301271 |
| Molecular Formula | C29H23FN6O2S |
| Molecular Weight | 538.61 g/mol |
| Exact Mass | 538.16 |
| IUPAC Name | N-[4-[1-(benzenesulfonyl)indol-3-yl]-5-fluoropyrimidin-2-yl]-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indol-8-amine |
| SMILES | O=S(=O)(c1ccccc1)n1cc(-c2nc(Nc3ccc4[nH]c5c(c4c3)CNCC5)ncc2F)c2ccccc21 |
| InChI | InChI=1S/C29H23FN6O2S/c30-24-16-32-29(33-18-10-11-25-21(14-18)22-15-31-13-12-26(22)34-25)35-28(24)23-17-36(27-9-5-4-8-20(23)27)39(37,38)19-6-2-1-3-7-19/h1-11,14,16-17,31,34H,12-13,15H2,(H,32,33,35) |
| InChIKey | FEKBWTAKWCKUEA-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 104.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.61 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|