ethyl 2-[7-[(3-fluorophenyl)methoxy]quinolin-3-yl]acetate

C20H18FNO3 — CID 86301488

IUPACethyl 2-[7-[(3-fluorophenyl)methoxy]quinolin-3-yl]acetate
SMILESCCOC(=O)Cc1cnc2cc(OCc3cccc(F)c3)ccc2c1
InChIInChI=1S/C20H18FNO3/c1-2-24-20(23)10-15-8-16-6-7-18(11-19(16)22-12-15)25-13-14-4-3-5-17(21)9-14/h3-9,11-12H,2,10,13H2,1H3
InChIKeyKJOVRVGHRPGALT-UHFFFAOYSA-N
MW339.37 g/mol
LogP4.06
Rot. Bonds6

About ethyl 2-[7-[(3-fluorophenyl)methoxy]quinolin-3-yl]acetate

ethyl 2-[7-[(3-fluorophenyl)methoxy]quinolin-3-yl]acetate (PubChem CID 86301488) has the molecular formula C20H18FNO3 and a molecular weight of 339.37 g/mol. Its IUPAC name is ethyl 2-[7-[(3-fluorophenyl)methoxy]quinolin-3-yl]acetate.

Molecular Properties

Compound Nameethyl 2-[7-[(3-fluorophenyl)methoxy]quinolin-3-yl]acetate
PubChem CID86301488
Molecular FormulaC20H18FNO3
Molecular Weight339.37 g/mol
Exact Mass339.13
IUPAC Nameethyl 2-[7-[(3-fluorophenyl)methoxy]quinolin-3-yl]acetate
SMILESCCOC(=O)Cc1cnc2cc(OCc3cccc(F)c3)ccc2c1
InChIInChI=1S/C20H18FNO3/c1-2-24-20(23)10-15-8-16-6-7-18(11-19(16)22-12-15)25-13-14-4-3-5-17(21)9-14/h3-9,11-12H,2,10,13H2,1H3
InChIKeyKJOVRVGHRPGALT-UHFFFAOYSA-N
XLogP4.06
TPSA48.42 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms25
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500339.37
LogP ≤ 54.06
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze ethyl 2-[7-[(3-fluorophenyl)methoxy]quinolin-3-yl]acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 2-[7-[(3-fluorophenyl)methoxy]quinolin-3-yl]acetate?
The IUPAC name of ethyl 2-[7-[(3-fluorophenyl)methoxy]quinolin-3-yl]acetate (CID 86301488) is ethyl 2-[7-[(3-fluorophenyl)methoxy]quinolin-3-yl]acetate.
What is the SMILES notation for ethyl 2-[7-[(3-fluorophenyl)methoxy]quinolin-3-yl]acetate?
The canonical SMILES for ethyl 2-[7-[(3-fluorophenyl)methoxy]quinolin-3-yl]acetate is CCOC(=O)Cc1cnc2cc(OCc3cccc(F)c3)ccc2c1.
What is the InChIKey of ethyl 2-[7-[(3-fluorophenyl)methoxy]quinolin-3-yl]acetate?
The InChIKey is KJOVRVGHRPGALT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18FNO3/c1-2-24-20(23)10-15-8-16-6-7-18(11-19(16)22-12-15)25-13-14-4-3-5-17(21)9-14/h3-9,11-12H,2,10,13H2,1H3.
What are the key properties of ethyl 2-[7-[(3-fluorophenyl)methoxy]quinolin-3-yl]acetate?
ethyl 2-[7-[(3-fluorophenyl)methoxy]quinolin-3-yl]acetate has a molecular weight of 339.37 g/mol, XLogP of 4.06, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[7-[(3-fluorophenyl)methoxy]quinolin-3-yl]acetate is sourced from PubChem (CID 86301488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).