About 3-(3-phenylphenyl)-3-(1,3-thiazol-2-yl)propanoic acid
3-(3-phenylphenyl)-3-(1,3-thiazol-2-yl)propanoic acid (PubChem CID 86301987) has the molecular formula C18H15NO2S
and a molecular weight of 309.39 g/mol. Its IUPAC name is 3-(3-phenylphenyl)-3-(1,3-thiazol-2-yl)propanoic acid.
Molecular Properties
| Compound Name | 3-(3-phenylphenyl)-3-(1,3-thiazol-2-yl)propanoic acid |
| PubChem CID | 86301987 |
| Molecular Formula | C18H15NO2S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | 3-(3-phenylphenyl)-3-(1,3-thiazol-2-yl)propanoic acid |
| SMILES | O=C(O)CC(c1cccc(-c2ccccc2)c1)c1nccs1 |
| InChI | InChI=1S/C18H15NO2S/c20-17(21)12-16(18-19-9-10-22-18)15-8-4-7-14(11-15)13-5-2-1-3-6-13/h1-11,16H,12H2,(H,20,21) |
| InChIKey | MGSWYLXRNPBIPP-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(3-phenylphenyl)-3-(1,3-thiazol-2-yl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-phenylphenyl)-3-(1,3-thiazol-2-yl)propanoic acid?
The IUPAC name of 3-(3-phenylphenyl)-3-(1,3-thiazol-2-yl)propanoic acid (CID 86301987) is 3-(3-phenylphenyl)-3-(1,3-thiazol-2-yl)propanoic acid.
What is the SMILES notation for 3-(3-phenylphenyl)-3-(1,3-thiazol-2-yl)propanoic acid?
The canonical SMILES for 3-(3-phenylphenyl)-3-(1,3-thiazol-2-yl)propanoic acid is O=C(O)CC(c1cccc(-c2ccccc2)c1)c1nccs1.
What is the InChIKey of 3-(3-phenylphenyl)-3-(1,3-thiazol-2-yl)propanoic acid?
The InChIKey is MGSWYLXRNPBIPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15NO2S/c20-17(21)12-16(18-19-9-10-22-18)15-8-4-7-14(11-15)13-5-2-1-3-6-13/h1-11,16H,12H2,(H,20,21).
What are the key properties of 3-(3-phenylphenyl)-3-(1,3-thiazol-2-yl)propanoic acid?
3-(3-phenylphenyl)-3-(1,3-thiazol-2-yl)propanoic acid has a molecular weight of 309.39 g/mol, XLogP of 4.42, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-phenylphenyl)-3-(1,3-thiazol-2-yl)propanoic acid is sourced from PubChem (CID 86301987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).