About N-[6-(1H-pyrrolo[2,3-b]pyridin-5-yl)-2-pyridinyl]prop-2-ynamide
N-[6-(1H-pyrrolo[2,3-b]pyridin-5-yl)-2-pyridinyl]prop-2-ynamide (PubChem CID 86302098) has the molecular formula C15H10N4O
and a molecular weight of 262.27 g/mol. Its IUPAC name is N-[6-(1H-pyrrolo[2,3-b]pyridin-5-yl)-2-pyridinyl]prop-2-ynamide.
Molecular Properties
| Compound Name | N-[6-(1H-pyrrolo[2,3-b]pyridin-5-yl)-2-pyridinyl]prop-2-ynamide |
| PubChem CID | 86302098 |
| Molecular Formula | C15H10N4O |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | N-[6-(1H-pyrrolo[2,3-b]pyridin-5-yl)-2-pyridinyl]prop-2-ynamide |
| SMILES | C#CC(=O)Nc1cccc(-c2cnc3[nH]ccc3c2)n1 |
| InChI | InChI=1S/C15H10N4O/c1-2-14(20)19-13-5-3-4-12(18-13)11-8-10-6-7-16-15(10)17-9-11/h1,3-9H,(H,16,17)(H,18,19,20) |
| InChIKey | YVMSMMXWFIRZCX-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[6-(1H-pyrrolo[2,3-b]pyridin-5-yl)-2-pyridinyl]prop-2-ynamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[6-(1H-pyrrolo[2,3-b]pyridin-5-yl)-2-pyridinyl]prop-2-ynamide?
The IUPAC name of N-[6-(1H-pyrrolo[2,3-b]pyridin-5-yl)-2-pyridinyl]prop-2-ynamide (CID 86302098) is N-[6-(1H-pyrrolo[2,3-b]pyridin-5-yl)-2-pyridinyl]prop-2-ynamide.
What is the SMILES notation for N-[6-(1H-pyrrolo[2,3-b]pyridin-5-yl)-2-pyridinyl]prop-2-ynamide?
The canonical SMILES for N-[6-(1H-pyrrolo[2,3-b]pyridin-5-yl)-2-pyridinyl]prop-2-ynamide is C#CC(=O)Nc1cccc(-c2cnc3[nH]ccc3c2)n1.
What is the InChIKey of N-[6-(1H-pyrrolo[2,3-b]pyridin-5-yl)-2-pyridinyl]prop-2-ynamide?
The InChIKey is YVMSMMXWFIRZCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10N4O/c1-2-14(20)19-13-5-3-4-12(18-13)11-8-10-6-7-16-15(10)17-9-11/h1,3-9H,(H,16,17)(H,18,19,20).
What are the key properties of N-[6-(1H-pyrrolo[2,3-b]pyridin-5-yl)-2-pyridinyl]prop-2-ynamide?
N-[6-(1H-pyrrolo[2,3-b]pyridin-5-yl)-2-pyridinyl]prop-2-ynamide has a molecular weight of 262.27 g/mol, XLogP of 2.20, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[6-(1H-pyrrolo[2,3-b]pyridin-5-yl)-2-pyridinyl]prop-2-ynamide is sourced from PubChem (CID 86302098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).