C32H38O5 — CID 86302537
(1R,3S,5R,7S,8S)-1-benzoyl-6,6-dimethyl-3,5-bis(3-methylbut-2-enyl)-8-(2-oxopropyl)adamantane-2,4,9-trione (PubChem CID 86302537) has the molecular formula C32H38O5 and a molecular weight of 502.65 g/mol. Its IUPAC name is (1R,3S,5R,7S,8S)-1-benzoyl-6,6-dimethyl-3,5-bis(3-methylbut-2-enyl)-8-(2-oxopropyl)adamantane-2,4,9-trione.
| Compound Name | (1R,3S,5R,7S,8S)-1-benzoyl-6,6-dimethyl-3,5-bis(3-methylbut-2-enyl)-8-(2-oxopropyl)adamantane-2,4,9-trione |
|---|---|
| PubChem CID | 86302537 |
| Molecular Formula | C32H38O5 |
| Molecular Weight | 502.65 g/mol |
| Exact Mass | 502.27 |
| IUPAC Name | (1R,3S,5R,7S,8S)-1-benzoyl-6,6-dimethyl-3,5-bis(3-methylbut-2-enyl)-8-(2-oxopropyl)adamantane-2,4,9-trione |
| SMILES | CC(=O)C[C@H]1[C@@H]2C[C@]3(CC=C(C)C)C(=O)[C@@]1(C(=O)c1ccccc1)C(=O)[C@@](CC=C(C)C)(C3=O)C2(C)C |
| InChI | InChI=1S/C32H38O5/c1-19(2)13-15-30-18-24-23(17-21(5)33)32(27(30)36,25(34)22-11-9-8-10-12-22)28(37)31(26(30)35,29(24,6)7)16-14-20(3)4/h8-14,23-24H,15-18H2,1-7H3/t23-,24-,30-,31+,32+/m0/s1 |
| InChIKey | VFDSADAZGWKTDR-FURYIGOFSA-N |
| XLogP | 5.92 |
| TPSA | 85.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.65 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|