About 9-(difluoromethyl)-3-[2-[(3-pyrimidin-5-yl-2-pyridinyl)oxy]ethyl]pyrido[2,3-b]indole
9-(difluoromethyl)-3-[2-[(3-pyrimidin-5-yl-2-pyridinyl)oxy]ethyl]pyrido[2,3-b]indole (PubChem CID 86302603) has the molecular formula C23H17F2N5O
and a molecular weight of 417.42 g/mol. Its IUPAC name is 9-(difluoromethyl)-3-[2-[(3-pyrimidin-5-yl-2-pyridinyl)oxy]ethyl]pyrido[2,3-b]indole.
Molecular Properties
| Compound Name | 9-(difluoromethyl)-3-[2-[(3-pyrimidin-5-yl-2-pyridinyl)oxy]ethyl]pyrido[2,3-b]indole |
| PubChem CID | 86302603 |
| Molecular Formula | C23H17F2N5O |
| Molecular Weight | 417.42 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | 9-(difluoromethyl)-3-[2-[(3-pyrimidin-5-yl-2-pyridinyl)oxy]ethyl]pyrido[2,3-b]indole |
| SMILES | FC(F)n1c2ccccc2c2cc(CCOc3ncccc3-c3cncnc3)cnc21 |
| InChI | InChI=1S/C23H17F2N5O/c24-23(25)30-20-6-2-1-4-18(20)19-10-15(11-29-21(19)30)7-9-31-22-17(5-3-8-28-22)16-12-26-14-27-13-16/h1-6,8,10-14,23H,7,9H2 |
| InChIKey | JFSHMCVQFGKMLC-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 65.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 417.42 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 9-(difluoromethyl)-3-[2-[(3-pyrimidin-5-yl-2-pyridinyl)oxy]ethyl]pyrido[2,3-b]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-(difluoromethyl)-3-[2-[(3-pyrimidin-5-yl-2-pyridinyl)oxy]ethyl]pyrido[2,3-b]indole?
The IUPAC name of 9-(difluoromethyl)-3-[2-[(3-pyrimidin-5-yl-2-pyridinyl)oxy]ethyl]pyrido[2,3-b]indole (CID 86302603) is 9-(difluoromethyl)-3-[2-[(3-pyrimidin-5-yl-2-pyridinyl)oxy]ethyl]pyrido[2,3-b]indole.
What is the SMILES notation for 9-(difluoromethyl)-3-[2-[(3-pyrimidin-5-yl-2-pyridinyl)oxy]ethyl]pyrido[2,3-b]indole?
The canonical SMILES for 9-(difluoromethyl)-3-[2-[(3-pyrimidin-5-yl-2-pyridinyl)oxy]ethyl]pyrido[2,3-b]indole is FC(F)n1c2ccccc2c2cc(CCOc3ncccc3-c3cncnc3)cnc21.
What is the InChIKey of 9-(difluoromethyl)-3-[2-[(3-pyrimidin-5-yl-2-pyridinyl)oxy]ethyl]pyrido[2,3-b]indole?
The InChIKey is JFSHMCVQFGKMLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H17F2N5O/c24-23(25)30-20-6-2-1-4-18(20)19-10-15(11-29-21(19)30)7-9-31-22-17(5-3-8-28-22)16-12-26-14-27-13-16/h1-6,8,10-14,23H,7,9H2.
What are the key properties of 9-(difluoromethyl)-3-[2-[(3-pyrimidin-5-yl-2-pyridinyl)oxy]ethyl]pyrido[2,3-b]indole?
9-(difluoromethyl)-3-[2-[(3-pyrimidin-5-yl-2-pyridinyl)oxy]ethyl]pyrido[2,3-b]indole has a molecular weight of 417.42 g/mol, XLogP of 5.06, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(difluoromethyl)-3-[2-[(3-pyrimidin-5-yl-2-pyridinyl)oxy]ethyl]pyrido[2,3-b]indole is sourced from PubChem (CID 86302603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).