C13H25N3O8 — CID 86302707
2-[[(1S,3R,4R,6S)-3-(carboxymethylamino)-2,4,6-trihydroxy-5-(3-hydroxypropylamino)cyclohexyl]amino]acetic acid (PubChem CID 86302707) has the molecular formula C13H25N3O8 and a molecular weight of 351.36 g/mol. Its IUPAC name is 2-[[(1S,3R,4R,6S)-3-(carboxymethylamino)-2,4,6-trihydroxy-5-(3-hydroxypropylamino)cyclohexyl]amino]acetic acid.
| Compound Name | 2-[[(1S,3R,4R,6S)-3-(carboxymethylamino)-2,4,6-trihydroxy-5-(3-hydroxypropylamino)cyclohexyl]amino]acetic acid |
|---|---|
| PubChem CID | 86302707 |
| Molecular Formula | C13H25N3O8 |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | 2-[[(1S,3R,4R,6S)-3-(carboxymethylamino)-2,4,6-trihydroxy-5-(3-hydroxypropylamino)cyclohexyl]amino]acetic acid |
| SMILES | O=C(O)CN[C@@H]1C(O)[C@H](NCC(=O)O)[C@H](O)C(NCCCO)[C@@H]1O |
| InChI | InChI=1S/C13H25N3O8/c17-3-1-2-14-8-11(22)9(15-4-6(18)19)13(24)10(12(8)23)16-5-7(20)21/h8-17,22-24H,1-5H2,(H,18,19)(H,20,21)/t8?,9-,10+,11-,12+,13? |
| InChIKey | OSNDQJXOQXBCRL-NLGNHUGYSA-N |
| XLogP | -4.49 |
| TPSA | 191.61 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | -4.49 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|