C13H23N3O9 — CID 86302709
3-[[(2R,3R,5S,6S)-3,5-bis(carboxymethylamino)-2,4,6-trihydroxycyclohexyl]amino]propanoic acid (PubChem CID 86302709) has the molecular formula C13H23N3O9 and a molecular weight of 365.34 g/mol. Its IUPAC name is 3-[[(2R,3R,5S,6S)-3,5-bis(carboxymethylamino)-2,4,6-trihydroxycyclohexyl]amino]propanoic acid.
| Compound Name | 3-[[(2R,3R,5S,6S)-3,5-bis(carboxymethylamino)-2,4,6-trihydroxycyclohexyl]amino]propanoic acid |
|---|---|
| PubChem CID | 86302709 |
| Molecular Formula | C13H23N3O9 |
| Molecular Weight | 365.34 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 3-[[(2R,3R,5S,6S)-3,5-bis(carboxymethylamino)-2,4,6-trihydroxycyclohexyl]amino]propanoic acid |
| SMILES | O=C(O)CCNC1[C@@H](O)[C@@H](NCC(=O)O)C(O)[C@@H](NCC(=O)O)[C@H]1O |
| InChI | InChI=1S/C13H23N3O9/c17-5(18)1-2-14-8-11(23)9(15-3-6(19)20)13(25)10(12(8)24)16-4-7(21)22/h8-16,23-25H,1-4H2,(H,17,18)(H,19,20)(H,21,22)/t8?,9-,10+,11-,12+,13? |
| InChIKey | UJBHDZBVDFNLKH-NLGNHUGYSA-N |
| XLogP | -4.40 |
| TPSA | 208.68 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.34 |
| LogP ≤ 5 | -4.40 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |