C50H95N5O — CID 86302774
1,4-bis[2-(dimethylamino)ethyl]-N-[(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl]piperazine-2-carboxamide (PubChem CID 86302774) has the molecular formula C50H95N5O and a molecular weight of 782.34 g/mol. Its IUPAC name is 1,4-bis[2-(dimethylamino)ethyl]-N-[(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl]piperazine-2-carboxamide.
| Compound Name | 1,4-bis[2-(dimethylamino)ethyl]-N-[(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl]piperazine-2-carboxamide |
|---|---|
| PubChem CID | 86302774 |
| Molecular Formula | C50H95N5O |
| Molecular Weight | 782.34 g/mol |
| Exact Mass | 781.75 |
| IUPAC Name | 1,4-bis[2-(dimethylamino)ethyl]-N-[(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl]piperazine-2-carboxamide |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC(CCCCCCCC/C=C\C/C=C\CCCCC)NC(=O)C1CN(CCN(C)C)CCN1CCN(C)C |
| InChI | InChI=1S/C50H95N5O/c1-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-39-48(40-38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-2)51-50(56)49-47-54(43-41-52(3)4)44-46-55(49)45-42-53(5)6/h15-18,21-24,48-49H,7-14,19-20,25-47H2,1-6H3,(H,51,56)/b17-15-,18-16-,23-21-,24-22- |
| InChIKey | OMZQNANFMRUDFE-MLLZQYMOSA-N |
| XLogP | 11.99 |
| TPSA | 42.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.34 |
| LogP ≤ 5 | 11.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|