C22H28N2O3 — CID 86302835
ethyl (1R,15S,17S)-17-ethyl-7-hydroxy-3,13-diazapentacyclo[13.3.1.02,10.04,9.013,18]nonadeca-2(10),4(9),5,7-tetraene-3-carboxylate (PubChem CID 86302835) has the molecular formula C22H28N2O3 and a molecular weight of 368.48 g/mol. Its IUPAC name is ethyl (1R,15S,17S)-17-ethyl-7-hydroxy-3,13-diazapentacyclo[13.3.1.02,10.04,9.013,18]nonadeca-2(10),4(9),5,7-tetraene-3-carboxylate.
| Compound Name | ethyl (1R,15S,17S)-17-ethyl-7-hydroxy-3,13-diazapentacyclo[13.3.1.02,10.04,9.013,18]nonadeca-2(10),4(9),5,7-tetraene-3-carboxylate |
|---|---|
| PubChem CID | 86302835 |
| Molecular Formula | C22H28N2O3 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | ethyl (1R,15S,17S)-17-ethyl-7-hydroxy-3,13-diazapentacyclo[13.3.1.02,10.04,9.013,18]nonadeca-2(10),4(9),5,7-tetraene-3-carboxylate |
| SMILES | CCOC(=O)n1c2c(c3cc(O)ccc31)CCN1C[C@H]3C[C@H](CC)C1[C@H]2C3 |
| InChI | InChI=1S/C22H28N2O3/c1-3-14-9-13-10-18-20(14)23(12-13)8-7-16-17-11-15(25)5-6-19(17)24(21(16)18)22(26)27-4-2/h5-6,11,13-14,18,20,25H,3-4,7-10,12H2,1-2H3/t13-,14-,18+,20?/m0/s1 |
| InChIKey | OBKURPSFBPDPMR-ZVPDZQSXSA-N |
| XLogP | 4.11 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |