C14H25N3O10 — CID 86302872
2-[[(2S,3S,5R,6R)-3,5-bis(carboxymethylamino)-2,4,6-trihydroxycyclohexyl]amino]-4-hydroxybutanoic acid (PubChem CID 86302872) has the molecular formula C14H25N3O10 and a molecular weight of 395.37 g/mol. Its IUPAC name is 2-[[(2S,3S,5R,6R)-3,5-bis(carboxymethylamino)-2,4,6-trihydroxycyclohexyl]amino]-4-hydroxybutanoic acid.
| Compound Name | 2-[[(2S,3S,5R,6R)-3,5-bis(carboxymethylamino)-2,4,6-trihydroxycyclohexyl]amino]-4-hydroxybutanoic acid |
|---|---|
| PubChem CID | 86302872 |
| Molecular Formula | C14H25N3O10 |
| Molecular Weight | 395.37 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | 2-[[(2S,3S,5R,6R)-3,5-bis(carboxymethylamino)-2,4,6-trihydroxycyclohexyl]amino]-4-hydroxybutanoic acid |
| SMILES | O=C(O)CN[C@@H]1C(O)[C@H](NCC(=O)O)[C@H](O)C(NC(CCO)C(=O)O)[C@@H]1O |
| InChI | InChI=1S/C14H25N3O10/c18-2-1-5(14(26)27)17-10-12(24)8(15-3-6(19)20)11(23)9(13(10)25)16-4-7(21)22/h5,8-13,15-18,23-25H,1-4H2,(H,19,20)(H,21,22)(H,26,27)/t5?,8-,9+,10?,11?,12-,13+ |
| InChIKey | UWCBBPWFHAFCNH-YULPXAIASA-N |
| XLogP | -5.04 |
| TPSA | 228.91 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.37 |
| LogP ≤ 5 | -5.04 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 10 |