C26H34N8O2 — CID 86302986
4-[[5-[4-(2-ethoxyethyl)piperazin-1-yl]-2-pyridinyl]amino]spiro[1,3,5,11-tetrazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraene-13,1'-cyclopentane]-10-one (PubChem CID 86302986) has the molecular formula C26H34N8O2 and a molecular weight of 490.61 g/mol. Its IUPAC name is 4-[[5-[4-(2-ethoxyethyl)piperazin-1-yl]-2-pyridinyl]amino]spiro[1,3,5,11-tetrazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraene-13,1'-cyclopentane]-10-one.
| Compound Name | 4-[[5-[4-(2-ethoxyethyl)piperazin-1-yl]-2-pyridinyl]amino]spiro[1,3,5,11-tetrazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraene-13,1'-cyclopentane]-10-one |
|---|---|
| PubChem CID | 86302986 |
| Molecular Formula | C26H34N8O2 |
| Molecular Weight | 490.61 g/mol |
| Exact Mass | 490.28 |
| IUPAC Name | 4-[[5-[4-(2-ethoxyethyl)piperazin-1-yl]-2-pyridinyl]amino]spiro[1,3,5,11-tetrazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraene-13,1'-cyclopentane]-10-one |
| SMILES | CCOCCN1CCN(c2ccc(Nc3ncc4cc5n(c4n3)C3(CCCC3)CNC5=O)nc2)CC1 |
| InChI | InChI=1S/C26H34N8O2/c1-2-36-14-13-32-9-11-33(12-10-32)20-5-6-22(27-17-20)30-25-28-16-19-15-21-24(35)29-18-26(7-3-4-8-26)34(21)23(19)31-25/h5-6,15-17H,2-4,7-14,18H2,1H3,(H,29,35)(H,27,28,30,31) |
| InChIKey | GLRKPAPXDMFPQG-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 100.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.61 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|