C20H18FN3O6 — CID 8630310
[2-[2-(2-fluorobenzoyl)hydrazinyl]-2-oxoethyl] 2-(4-oxo-2,3-dihydro-1,5-benzoxazepin-5-yl)acetate (PubChem CID 8630310) has the molecular formula C20H18FN3O6 and a molecular weight of 415.38 g/mol. Its IUPAC name is [2-[2-(2-fluorobenzoyl)hydrazinyl]-2-oxoethyl] 2-(4-oxo-2,3-dihydro-1,5-benzoxazepin-5-yl)acetate.
| Compound Name | [2-[2-(2-fluorobenzoyl)hydrazinyl]-2-oxoethyl] 2-(4-oxo-2,3-dihydro-1,5-benzoxazepin-5-yl)acetate |
|---|---|
| PubChem CID | 8630310 |
| Molecular Formula | C20H18FN3O6 |
| Molecular Weight | 415.38 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | [2-[2-(2-fluorobenzoyl)hydrazinyl]-2-oxoethyl] 2-(4-oxo-2,3-dihydro-1,5-benzoxazepin-5-yl)acetate |
| SMILES | O=C(COC(=O)CN1C(=O)CCOc2ccccc21)NNC(=O)c1ccccc1F |
| InChI | InChI=1S/C20H18FN3O6/c21-14-6-2-1-5-13(14)20(28)23-22-17(25)12-30-19(27)11-24-15-7-3-4-8-16(15)29-10-9-18(24)26/h1-8H,9-12H2,(H,22,25)(H,23,28) |
| InChIKey | JMAGNDYCTLDVOO-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.38 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|