C22H14F3N4O6PS — CID 86303122
[2,4-dioxo-9-thiophen-3-yl-1-[3-(trifluoromethyl)phenyl]pyrimido[5,4-c][1,5]naphthyridin-3-yl]methyl dihydrogen phosphate (PubChem CID 86303122) has the molecular formula C22H14F3N4O6PS and a molecular weight of 550.41 g/mol. Its IUPAC name is [2,4-dioxo-9-thiophen-3-yl-1-[3-(trifluoromethyl)phenyl]pyrimido[5,4-c][1,5]naphthyridin-3-yl]methyl dihydrogen phosphate.
| Compound Name | [2,4-dioxo-9-thiophen-3-yl-1-[3-(trifluoromethyl)phenyl]pyrimido[5,4-c][1,5]naphthyridin-3-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 86303122 |
| Molecular Formula | C22H14F3N4O6PS |
| Molecular Weight | 550.41 g/mol |
| Exact Mass | 550.03 |
| IUPAC Name | [2,4-dioxo-9-thiophen-3-yl-1-[3-(trifluoromethyl)phenyl]pyrimido[5,4-c][1,5]naphthyridin-3-yl]methyl dihydrogen phosphate |
| SMILES | O=c1c2cnc3ccc(-c4ccsc4)nc3c2n(-c2cccc(C(F)(F)F)c2)c(=O)n1COP(=O)(O)O |
| InChI | InChI=1S/C22H14F3N4O6PS/c23-22(24,25)13-2-1-3-14(8-13)29-19-15(20(30)28(21(29)31)11-35-36(32,33)34)9-26-17-5-4-16(27-18(17)19)12-6-7-37-10-12/h1-10H,11H2,(H2,32,33,34) |
| InChIKey | NKFPFFBUWGUZET-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 136.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.41 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|