C19H16F4N2O2 — CID 86303140
(1S)-1-(3-fluoro-2-methylphenyl)-N-hydroxy-3-[6-(trifluoromethyl)-3-pyridinyl]cyclopent-2-ene-1-carboxamide (PubChem CID 86303140) has the molecular formula C19H16F4N2O2 and a molecular weight of 380.34 g/mol. Its IUPAC name is (1S)-1-(3-fluoro-2-methylphenyl)-N-hydroxy-3-[6-(trifluoromethyl)-3-pyridinyl]cyclopent-2-ene-1-carboxamide.
| Compound Name | (1S)-1-(3-fluoro-2-methylphenyl)-N-hydroxy-3-[6-(trifluoromethyl)-3-pyridinyl]cyclopent-2-ene-1-carboxamide |
|---|---|
| PubChem CID | 86303140 |
| Molecular Formula | C19H16F4N2O2 |
| Molecular Weight | 380.34 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | (1S)-1-(3-fluoro-2-methylphenyl)-N-hydroxy-3-[6-(trifluoromethyl)-3-pyridinyl]cyclopent-2-ene-1-carboxamide |
| SMILES | Cc1c(F)cccc1[C@@]1(C(=O)NO)C=C(c2ccc(C(F)(F)F)nc2)CC1 |
| InChI | InChI=1S/C19H16F4N2O2/c1-11-14(3-2-4-15(11)20)18(17(26)25-27)8-7-12(9-18)13-5-6-16(24-10-13)19(21,22)23/h2-6,9-10,27H,7-8H2,1H3,(H,25,26)/t18-/m0/s1 |
| InChIKey | HQDKBLZLYAJTGA-SFHVURJKSA-N |
| XLogP | 4.17 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.34 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|