About (Z)-2-(3,5-dimethoxyphenyl)-3-(1H-indol-3-yl)prop-2-enenitrile
(Z)-2-(3,5-dimethoxyphenyl)-3-(1H-indol-3-yl)prop-2-enenitrile (PubChem CID 86303308) has the molecular formula C19H16N2O2
and a molecular weight of 304.35 g/mol. Its IUPAC name is (Z)-2-(3,5-dimethoxyphenyl)-3-(1H-indol-3-yl)prop-2-enenitrile.
Molecular Properties
| Compound Name | (Z)-2-(3,5-dimethoxyphenyl)-3-(1H-indol-3-yl)prop-2-enenitrile |
| PubChem CID | 86303308 |
| Molecular Formula | C19H16N2O2 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | (Z)-2-(3,5-dimethoxyphenyl)-3-(1H-indol-3-yl)prop-2-enenitrile |
| SMILES | COc1cc(OC)cc(/C(C#N)=C/c2c[nH]c3ccccc23)c1 |
| InChI | InChI=1S/C19H16N2O2/c1-22-16-8-13(9-17(10-16)23-2)14(11-20)7-15-12-21-19-6-4-3-5-18(15)19/h3-10,12,21H,1-2H3/b14-7+ |
| InChIKey | OOWIFBNETKXILE-VGOFMYFVSA-N |
| XLogP | 4.25 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2-(3,5-dimethoxyphenyl)-3-(1H-indol-3-yl)prop-2-enenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-(3,5-dimethoxyphenyl)-3-(1H-indol-3-yl)prop-2-enenitrile?
The IUPAC name of (Z)-2-(3,5-dimethoxyphenyl)-3-(1H-indol-3-yl)prop-2-enenitrile (CID 86303308) is (Z)-2-(3,5-dimethoxyphenyl)-3-(1H-indol-3-yl)prop-2-enenitrile.
What is the SMILES notation for (Z)-2-(3,5-dimethoxyphenyl)-3-(1H-indol-3-yl)prop-2-enenitrile?
The canonical SMILES for (Z)-2-(3,5-dimethoxyphenyl)-3-(1H-indol-3-yl)prop-2-enenitrile is COc1cc(OC)cc(/C(C#N)=C/c2c[nH]c3ccccc23)c1.
What is the InChIKey of (Z)-2-(3,5-dimethoxyphenyl)-3-(1H-indol-3-yl)prop-2-enenitrile?
The InChIKey is OOWIFBNETKXILE-VGOFMYFVSA-N. The full InChI is InChI=1S/C19H16N2O2/c1-22-16-8-13(9-17(10-16)23-2)14(11-20)7-15-12-21-19-6-4-3-5-18(15)19/h3-10,12,21H,1-2H3/b14-7+.
What are the key properties of (Z)-2-(3,5-dimethoxyphenyl)-3-(1H-indol-3-yl)prop-2-enenitrile?
(Z)-2-(3,5-dimethoxyphenyl)-3-(1H-indol-3-yl)prop-2-enenitrile has a molecular weight of 304.35 g/mol, XLogP of 4.25, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-(3,5-dimethoxyphenyl)-3-(1H-indol-3-yl)prop-2-enenitrile is sourced from PubChem (CID 86303308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).