About N'-[[3-(4-fluorophenyl)-1-(oxetan-3-yl)pyrazol-4-yl]methyl]-N'-methylethane-1,2-diamine
N'-[[3-(4-fluorophenyl)-1-(oxetan-3-yl)pyrazol-4-yl]methyl]-N'-methylethane-1,2-diamine (PubChem CID 86303376) has the molecular formula C16H21FN4O
and a molecular weight of 304.37 g/mol. Its IUPAC name is N'-[[3-(4-fluorophenyl)-1-(oxetan-3-yl)pyrazol-4-yl]methyl]-N'-methylethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-[[3-(4-fluorophenyl)-1-(oxetan-3-yl)pyrazol-4-yl]methyl]-N'-methylethane-1,2-diamine |
| PubChem CID | 86303376 |
| Molecular Formula | C16H21FN4O |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | N'-[[3-(4-fluorophenyl)-1-(oxetan-3-yl)pyrazol-4-yl]methyl]-N'-methylethane-1,2-diamine |
| SMILES | CN(CCN)Cc1cn(C2COC2)nc1-c1ccc(F)cc1 |
| InChI | InChI=1S/C16H21FN4O/c1-20(7-6-18)8-13-9-21(15-10-22-11-15)19-16(13)12-2-4-14(17)5-3-12/h2-5,9,15H,6-8,10-11,18H2,1H3 |
| InChIKey | ZGALZMXVDREGPW-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 56.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N'-[[3-(4-fluorophenyl)-1-(oxetan-3-yl)pyrazol-4-yl]methyl]-N'-methylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[[3-(4-fluorophenyl)-1-(oxetan-3-yl)pyrazol-4-yl]methyl]-N'-methylethane-1,2-diamine?
The IUPAC name of N'-[[3-(4-fluorophenyl)-1-(oxetan-3-yl)pyrazol-4-yl]methyl]-N'-methylethane-1,2-diamine (CID 86303376) is N'-[[3-(4-fluorophenyl)-1-(oxetan-3-yl)pyrazol-4-yl]methyl]-N'-methylethane-1,2-diamine.
What is the SMILES notation for N'-[[3-(4-fluorophenyl)-1-(oxetan-3-yl)pyrazol-4-yl]methyl]-N'-methylethane-1,2-diamine?
The canonical SMILES for N'-[[3-(4-fluorophenyl)-1-(oxetan-3-yl)pyrazol-4-yl]methyl]-N'-methylethane-1,2-diamine is CN(CCN)Cc1cn(C2COC2)nc1-c1ccc(F)cc1.
What is the InChIKey of N'-[[3-(4-fluorophenyl)-1-(oxetan-3-yl)pyrazol-4-yl]methyl]-N'-methylethane-1,2-diamine?
The InChIKey is ZGALZMXVDREGPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21FN4O/c1-20(7-6-18)8-13-9-21(15-10-22-11-15)19-16(13)12-2-4-14(17)5-3-12/h2-5,9,15H,6-8,10-11,18H2,1H3.
What are the key properties of N'-[[3-(4-fluorophenyl)-1-(oxetan-3-yl)pyrazol-4-yl]methyl]-N'-methylethane-1,2-diamine?
N'-[[3-(4-fluorophenyl)-1-(oxetan-3-yl)pyrazol-4-yl]methyl]-N'-methylethane-1,2-diamine has a molecular weight of 304.37 g/mol, XLogP of 1.65, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[[3-(4-fluorophenyl)-1-(oxetan-3-yl)pyrazol-4-yl]methyl]-N'-methylethane-1,2-diamine is sourced from PubChem (CID 86303376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).