C27H20N7O6P — CID 86303429
[1-[4-(2-cyanopropan-2-yl)phenyl]-9-(6-cyano-3-pyridinyl)-2,4-dioxopyrimido[5,4-c][1,5]naphthyridin-3-yl]methyl dihydrogen phosphate (PubChem CID 86303429) has the molecular formula C27H20N7O6P and a molecular weight of 569.47 g/mol. Its IUPAC name is [1-[4-(2-cyanopropan-2-yl)phenyl]-9-(6-cyano-3-pyridinyl)-2,4-dioxopyrimido[5,4-c][1,5]naphthyridin-3-yl]methyl dihydrogen phosphate.
| Compound Name | [1-[4-(2-cyanopropan-2-yl)phenyl]-9-(6-cyano-3-pyridinyl)-2,4-dioxopyrimido[5,4-c][1,5]naphthyridin-3-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 86303429 |
| Molecular Formula | C27H20N7O6P |
| Molecular Weight | 569.47 g/mol |
| Exact Mass | 569.12 |
| IUPAC Name | [1-[4-(2-cyanopropan-2-yl)phenyl]-9-(6-cyano-3-pyridinyl)-2,4-dioxopyrimido[5,4-c][1,5]naphthyridin-3-yl]methyl dihydrogen phosphate |
| SMILES | CC(C)(C#N)c1ccc(-n2c(=O)n(COP(=O)(O)O)c(=O)c3cnc4ccc(-c5ccc(C#N)nc5)nc4c32)cc1 |
| InChI | InChI=1S/C27H20N7O6P/c1-27(2,14-29)17-4-7-19(8-5-17)34-24-20(25(35)33(26(34)36)15-40-41(37,38)39)13-31-22-10-9-21(32-23(22)24)16-3-6-18(11-28)30-12-16/h3-10,12-13H,15H2,1-2H3,(H2,37,38,39) |
| InChIKey | KWYSGBMTZSRSCQ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 197.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.47 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|