C27H21N6Na2O6PS — CID 86303432
disodium;[1-[4-(2-cyanopropan-2-yl)phenyl]-9-(6-methylsulfanyl-3-pyridinyl)-2,4-dioxopyrimido[5,4-c][1,5]naphthyridin-3-yl]methyl phosphate (PubChem CID 86303432) has the molecular formula C27H21N6Na2O6PS and a molecular weight of 634.52 g/mol. Its IUPAC name is disodium;[1-[4-(2-cyanopropan-2-yl)phenyl]-9-(6-methylsulfanyl-3-pyridinyl)-2,4-dioxopyrimido[5,4-c][1,5]naphthyridin-3-yl]methyl phosphate.
| Compound Name | disodium;[1-[4-(2-cyanopropan-2-yl)phenyl]-9-(6-methylsulfanyl-3-pyridinyl)-2,4-dioxopyrimido[5,4-c][1,5]naphthyridin-3-yl]methyl phosphate |
|---|---|
| PubChem CID | 86303432 |
| Molecular Formula | C27H21N6Na2O6PS |
| Molecular Weight | 634.52 g/mol |
| Exact Mass | 634.08 |
| IUPAC Name | disodium;[1-[4-(2-cyanopropan-2-yl)phenyl]-9-(6-methylsulfanyl-3-pyridinyl)-2,4-dioxopyrimido[5,4-c][1,5]naphthyridin-3-yl]methyl phosphate |
| SMILES | CSc1ccc(-c2ccc3ncc4c(=O)n(COP(=O)([O-])[O-])c(=O)n(-c5ccc(C(C)(C)C#N)cc5)c4c3n2)cn1.[Na+].[Na+] |
| InChI | InChI=1S/C27H23N6O6PS.2Na/c1-27(2,14-28)17-5-7-18(8-6-17)33-24-19(25(34)32(26(33)35)15-39-40(36,37)38)13-29-21-10-9-20(31-23(21)24)16-4-11-22(41-3)30-12-16;;/h4-13H,15H2,1-3H3,(H2,36,37,38);;/q;2*+1/p-2 |
| InChIKey | MBUSWPASWBFDCV-UHFFFAOYSA-L |
| XLogP | -3.51 |
| TPSA | 178.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.52 |
| LogP ≤ 5 | -3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|