C19H21Cl2N7O — CID 86303581
1-(2,6-dichloro-4-pyridinyl)-3-[(3-methyl-4-propan-2-yl-1-prop-2-enylpyrazolo[5,4-b]pyridin-6-yl)amino]urea (PubChem CID 86303581) has the molecular formula C19H21Cl2N7O and a molecular weight of 434.33 g/mol. Its IUPAC name is 1-(2,6-dichloro-4-pyridinyl)-3-[(3-methyl-4-propan-2-yl-1-prop-2-enylpyrazolo[5,4-b]pyridin-6-yl)amino]urea.
| Compound Name | 1-(2,6-dichloro-4-pyridinyl)-3-[(3-methyl-4-propan-2-yl-1-prop-2-enylpyrazolo[5,4-b]pyridin-6-yl)amino]urea |
|---|---|
| PubChem CID | 86303581 |
| Molecular Formula | C19H21Cl2N7O |
| Molecular Weight | 434.33 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | 1-(2,6-dichloro-4-pyridinyl)-3-[(3-methyl-4-propan-2-yl-1-prop-2-enylpyrazolo[5,4-b]pyridin-6-yl)amino]urea |
| SMILES | C=CCn1nc(C)c2c(C(C)C)cc(NNC(=O)Nc3cc(Cl)nc(Cl)c3)nc21 |
| InChI | InChI=1S/C19H21Cl2N7O/c1-5-6-28-18-17(11(4)27-28)13(10(2)3)9-16(24-18)25-26-19(29)22-12-7-14(20)23-15(21)8-12/h5,7-10H,1,6H2,2-4H3,(H,24,25)(H2,22,23,26,29) |
| InChIKey | QTRXSBUIHCYTDW-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 96.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.33 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|