C19H23Cl2N7O2 — CID 86303732
1-(2,6-dichloro-4-pyridinyl)-3-[(1,3-dimethyl-4-propan-2-ylpyrazolo[5,4-b]pyridin-6-yl)-(2-hydroxyethyl)amino]urea (PubChem CID 86303732) has the molecular formula C19H23Cl2N7O2 and a molecular weight of 452.35 g/mol. Its IUPAC name is 1-(2,6-dichloro-4-pyridinyl)-3-[(1,3-dimethyl-4-propan-2-ylpyrazolo[5,4-b]pyridin-6-yl)-(2-hydroxyethyl)amino]urea.
| Compound Name | 1-(2,6-dichloro-4-pyridinyl)-3-[(1,3-dimethyl-4-propan-2-ylpyrazolo[5,4-b]pyridin-6-yl)-(2-hydroxyethyl)amino]urea |
|---|---|
| PubChem CID | 86303732 |
| Molecular Formula | C19H23Cl2N7O2 |
| Molecular Weight | 452.35 g/mol |
| Exact Mass | 451.13 |
| IUPAC Name | 1-(2,6-dichloro-4-pyridinyl)-3-[(1,3-dimethyl-4-propan-2-ylpyrazolo[5,4-b]pyridin-6-yl)-(2-hydroxyethyl)amino]urea |
| SMILES | Cc1nn(C)c2nc(N(CCO)NC(=O)Nc3cc(Cl)nc(Cl)c3)cc(C(C)C)c12 |
| InChI | InChI=1S/C19H23Cl2N7O2/c1-10(2)13-9-16(24-18-17(13)11(3)25-27(18)4)28(5-6-29)26-19(30)22-12-7-14(20)23-15(21)8-12/h7-10,29H,5-6H2,1-4H3,(H2,22,23,26,30) |
| InChIKey | REWKMHWDRLICNF-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 108.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.35 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|