C21H28ClN7O3 — CID 86303735
1-(2-chloro-6-ethoxy-4-pyridinyl)-3-[(1,3-dimethyl-4-propan-2-ylpyrazolo[5,4-b]pyridin-6-yl)-(2-hydroxyethyl)amino]urea (PubChem CID 86303735) has the molecular formula C21H28ClN7O3 and a molecular weight of 461.95 g/mol. Its IUPAC name is 1-(2-chloro-6-ethoxy-4-pyridinyl)-3-[(1,3-dimethyl-4-propan-2-ylpyrazolo[5,4-b]pyridin-6-yl)-(2-hydroxyethyl)amino]urea.
| Compound Name | 1-(2-chloro-6-ethoxy-4-pyridinyl)-3-[(1,3-dimethyl-4-propan-2-ylpyrazolo[5,4-b]pyridin-6-yl)-(2-hydroxyethyl)amino]urea |
|---|---|
| PubChem CID | 86303735 |
| Molecular Formula | C21H28ClN7O3 |
| Molecular Weight | 461.95 g/mol |
| Exact Mass | 461.19 |
| IUPAC Name | 1-(2-chloro-6-ethoxy-4-pyridinyl)-3-[(1,3-dimethyl-4-propan-2-ylpyrazolo[5,4-b]pyridin-6-yl)-(2-hydroxyethyl)amino]urea |
| SMILES | CCOc1cc(NC(=O)NN(CCO)c2cc(C(C)C)c3c(C)nn(C)c3n2)cc(Cl)n1 |
| InChI | InChI=1S/C21H28ClN7O3/c1-6-32-18-10-14(9-16(22)24-18)23-21(31)27-29(7-8-30)17-11-15(12(2)3)19-13(4)26-28(5)20(19)25-17/h9-12,30H,6-8H2,1-5H3,(H2,23,24,27,31) |
| InChIKey | MREVGTRWACILNL-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 117.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.95 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|