C26H36N4O3 — CID 86303777
[(1R,15S,17S)-3-[2-(dimethylamino)ethylcarbamoyl]-17-ethyl-3,13-diazapentacyclo[13.3.1.02,10.04,9.013,18]nonadeca-2(10),4(9),5,7-tetraen-7-yl] acetate (PubChem CID 86303777) has the molecular formula C26H36N4O3 and a molecular weight of 452.60 g/mol. Its IUPAC name is [(1R,15S,17S)-3-[2-(dimethylamino)ethylcarbamoyl]-17-ethyl-3,13-diazapentacyclo[13.3.1.02,10.04,9.013,18]nonadeca-2(10),4(9),5,7-tetraen-7-yl] acetate.
| Compound Name | [(1R,15S,17S)-3-[2-(dimethylamino)ethylcarbamoyl]-17-ethyl-3,13-diazapentacyclo[13.3.1.02,10.04,9.013,18]nonadeca-2(10),4(9),5,7-tetraen-7-yl] acetate |
|---|---|
| PubChem CID | 86303777 |
| Molecular Formula | C26H36N4O3 |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.28 |
| IUPAC Name | [(1R,15S,17S)-3-[2-(dimethylamino)ethylcarbamoyl]-17-ethyl-3,13-diazapentacyclo[13.3.1.02,10.04,9.013,18]nonadeca-2(10),4(9),5,7-tetraen-7-yl] acetate |
| SMILES | CC[C@H]1C[C@H]2C[C@H]3c4c(c5cc(OC(C)=O)ccc5n4C(=O)NCCN(C)C)CCN(C2)C13 |
| InChI | InChI=1S/C26H36N4O3/c1-5-18-12-17-13-22-24(18)29(15-17)10-8-20-21-14-19(33-16(2)31)6-7-23(21)30(25(20)22)26(32)27-9-11-28(3)4/h6-7,14,17-18,22,24H,5,8-13,15H2,1-4H3,(H,27,32)/t17-,18-,22+,24?/m0/s1 |
| InChIKey | HNJNOFGOBZKZGK-UGIRWIENSA-N |
| XLogP | 3.45 |
| TPSA | 66.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|