C26H28FNO5 — CID 86304248
3-[2-fluoro-4-[[6-[4-(2-methoxyethoxy)-2,6-dimethylphenyl]-2-pyridinyl]oxymethyl]phenyl]propanoic acid (PubChem CID 86304248) has the molecular formula C26H28FNO5 and a molecular weight of 453.51 g/mol. Its IUPAC name is 3-[2-fluoro-4-[[6-[4-(2-methoxyethoxy)-2,6-dimethylphenyl]-2-pyridinyl]oxymethyl]phenyl]propanoic acid.
| Compound Name | 3-[2-fluoro-4-[[6-[4-(2-methoxyethoxy)-2,6-dimethylphenyl]-2-pyridinyl]oxymethyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 86304248 |
| Molecular Formula | C26H28FNO5 |
| Molecular Weight | 453.51 g/mol |
| Exact Mass | 453.20 |
| IUPAC Name | 3-[2-fluoro-4-[[6-[4-(2-methoxyethoxy)-2,6-dimethylphenyl]-2-pyridinyl]oxymethyl]phenyl]propanoic acid |
| SMILES | COCCOc1cc(C)c(-c2cccc(OCc3ccc(CCC(=O)O)c(F)c3)n2)c(C)c1 |
| InChI | InChI=1S/C26H28FNO5/c1-17-13-21(32-12-11-31-3)14-18(2)26(17)23-5-4-6-24(28-23)33-16-19-7-8-20(22(27)15-19)9-10-25(29)30/h4-8,13-15H,9-12,16H2,1-3H3,(H,29,30) |
| InChIKey | ORLIMUGBUYLHRF-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 77.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.51 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|