About N-(5-hydroxy-3,4,6-trimethyl-2-pyridinyl)-3-phenylpropanamide
N-(5-hydroxy-3,4,6-trimethyl-2-pyridinyl)-3-phenylpropanamide (PubChem CID 86304263) has the molecular formula C17H20N2O2
and a molecular weight of 284.36 g/mol. Its IUPAC name is N-(5-hydroxy-3,4,6-trimethyl-2-pyridinyl)-3-phenylpropanamide.
Molecular Properties
| Compound Name | N-(5-hydroxy-3,4,6-trimethyl-2-pyridinyl)-3-phenylpropanamide |
| PubChem CID | 86304263 |
| Molecular Formula | C17H20N2O2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | N-(5-hydroxy-3,4,6-trimethyl-2-pyridinyl)-3-phenylpropanamide |
| SMILES | Cc1nc(NC(=O)CCc2ccccc2)c(C)c(C)c1O |
| InChI | InChI=1S/C17H20N2O2/c1-11-12(2)17(18-13(3)16(11)21)19-15(20)10-9-14-7-5-4-6-8-14/h4-8,21H,9-10H2,1-3H3,(H,18,19,20) |
| InChIKey | ZYDRWSRPPQOAPW-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(5-hydroxy-3,4,6-trimethyl-2-pyridinyl)-3-phenylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-hydroxy-3,4,6-trimethyl-2-pyridinyl)-3-phenylpropanamide?
The IUPAC name of N-(5-hydroxy-3,4,6-trimethyl-2-pyridinyl)-3-phenylpropanamide (CID 86304263) is N-(5-hydroxy-3,4,6-trimethyl-2-pyridinyl)-3-phenylpropanamide.
What is the SMILES notation for N-(5-hydroxy-3,4,6-trimethyl-2-pyridinyl)-3-phenylpropanamide?
The canonical SMILES for N-(5-hydroxy-3,4,6-trimethyl-2-pyridinyl)-3-phenylpropanamide is Cc1nc(NC(=O)CCc2ccccc2)c(C)c(C)c1O.
What is the InChIKey of N-(5-hydroxy-3,4,6-trimethyl-2-pyridinyl)-3-phenylpropanamide?
The InChIKey is ZYDRWSRPPQOAPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20N2O2/c1-11-12(2)17(18-13(3)16(11)21)19-15(20)10-9-14-7-5-4-6-8-14/h4-8,21H,9-10H2,1-3H3,(H,18,19,20).
What are the key properties of N-(5-hydroxy-3,4,6-trimethyl-2-pyridinyl)-3-phenylpropanamide?
N-(5-hydroxy-3,4,6-trimethyl-2-pyridinyl)-3-phenylpropanamide has a molecular weight of 284.36 g/mol, XLogP of 3.28, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-hydroxy-3,4,6-trimethyl-2-pyridinyl)-3-phenylpropanamide is sourced from PubChem (CID 86304263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).